Compound Q&A

What industries use 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

Answer

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is primarily used in the pharmaceutical industry for drug synthesis. It is also utilized in the polymer industry for the development of special polymers. Additionally, it has applications in the sensor technology and semiconductor industries, where its unique functional groups facilitate specific interactions and chemical processes.

About

English Name 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
Molecular Formula C22H17NO4
Molecular Weight 359.38 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC=C4C(=O)O
InChIKey CNAVPEPPAVHHKN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is a crystalline white so...

Compound Q&A

How is 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) typically synthesized?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid is typically synthesized by reacting fluoren...

Compound Q&A

What precautions should be taken when handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

When handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...