Compound Q&A

What are the physical and chemical properties of 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

Answer

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is a crystalline white solid with a molecular weight of approximately 473.41 g/mol. It is slightly soluble in water and has good solubility in organic solvents. The compound is not particularly reactive under normal conditions but can undergo hydrolysis and other acid/base reactions. It is stable under neutral to slightly acidic conditions but should be handled with care to avoid strong bases or acids.

About

English Name 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
Molecular Formula C22H17NO4
Molecular Weight 359.38 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC=C4C(=O)O
InChIKey CNAVPEPPAVHHKN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) typically synthesized?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid is typically synthesized by reacting fluoren...

Compound Q&A

What industries use 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

When handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...