Compound Q&A

How is 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) typically synthesized?

Answer

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid is typically synthesized by reacting fluoren-9-ylmethanol with benzoic anhydride in the presence of a catalytic amount of a suitable acid, such as sulfuric acid. The reaction involves the formation of an ester followed by the introduction of an amino group. The yield is generally high, and the product can be purified by recrystallization from appropriate solvents.

About

English Name 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid
Molecular Formula C22H17NO4
Molecular Weight 359.38 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC=C4C(=O)O
InChIKey CNAVPEPPAVHHKN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is a crystalline white so...

Compound Q&A

What industries use 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1)?

When handling 2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid (CAS: 150256-42-1), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...