Compound Q&A

What industries use (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

Answer

(2E)-3-(1H-Indol-3-yl)acrylic acid
(2E)-3-(1H-Indol-3-yl)acrylic acid is primarily used in the pharmaceutical industry for the synthesis of bioactive compounds and in polymer science for the creation of functional materials. It also has applications in sensor technology and semiconductor manufacturing due to its chemical reactivity and ability to form stable complexes.

About

CAS No 29953-71-7
English Name (2E)-3-(1H-Indol-3-yl)acrylic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
InChIKey PLVPPLCLBIEYEA-AATRIKPKSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

(2E)-3-(1H-Indol-3-yl)acrylic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7) typically synthesized?

(2E)-3-(1H-Indol-3-yl)acrylic acid can be synthesized by the condensation of indole-3-carbaldehyde w...

Compound Q&A

What precautions should be taken when handling (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

When handling (2E)-3-(1H-Indol-3-yl)acrylic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...