Compound Q&A

What are the physical and chemical properties of (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

Answer

(2E)-3-(1H-Indol-3-yl)acrylic acid
(2E)-3-(1H-Indol-3-yl)acrylic acid is a crystalline solid with a molecular weight of approximately 201.24 g/mol. It has limited water solubility and is soluble in common organic solvents like methanol and ethanol. The compound is relatively stable under normal conditions but can undergo hydrolysis in basic conditions. It is used in organic synthesis and pharmaceutical applications.

About

CAS No 29953-71-7
English Name (2E)-3-(1H-Indol-3-yl)acrylic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
InChIKey PLVPPLCLBIEYEA-AATRIKPKSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7) typically synthesized?

(2E)-3-(1H-Indol-3-yl)acrylic acid can be synthesized by the condensation of indole-3-carbaldehyde w...

Compound Q&A

What industries use (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

(2E)-3-(1H-Indol-3-yl)acrylic acid is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling (2E)-3-(1H-Indol-3-yl)acrylic acid (CAS: 29953-71-7)?

When handling (2E)-3-(1H-Indol-3-yl)acrylic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...