Compound Q&A

What precautions should be taken when handling Liquidambaric lactone (CAS: 185051-75-6)?

Answer

Liquidambaric lactone
When handling Liquidambaric lactone (CAS: 185051-75-6), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation of the vapor. Spills should be cleaned up using appropriate absorbents, and the area should be carefully decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Liquidambaric lactone
Molecular Formula C30H44O4
Molecular Weight 468.67 g/mol
SMILES O=C1CCC2(C(C1(C)C)CCC1(C2C2OC2C23C1(C)CCC1(C3CC(C)(C)CC1)C(=O)O2)C)C
InChIKey ATQBPBZOVWXRTA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Liquidambaric lactone (CAS: 185051-75-6)?

Liquidambaric lactone (CAS: 185051-75-6) is a colorless to light yellow liquid with a strong, distin...

Compound Q&A

How is Liquidambaric lactone (CAS: 185051-75-6) typically synthesized?

Liquidambaric lactone (CAS: 185051-75-6) is typically synthesized through the oxidation of the corre...

Compound Q&A

What industries use Liquidambaric lactone (CAS: 185051-75-6)?

Liquidambaric lactone (CAS: 185051-75-6) is primarily used in the fragrance and flavor industry due ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...