Compound Q&A

What industries use Liquidambaric lactone (CAS: 185051-75-6)?

Answer

Liquidambaric lactone
Liquidambaric lactone (CAS: 185051-75-6) is primarily used in the fragrance and flavor industry due to its characteristic scent. It is also explored in the pharmaceutical industry for potential medicinal applications and in the polymer industry for modifying the properties of synthetic resins. Additionally, it is used in sensor technologies for detecting specific chemical compounds.

About

English Name Liquidambaric lactone
Molecular Formula C30H44O4
Molecular Weight 468.67 g/mol
SMILES O=C1CCC2(C(C1(C)C)CCC1(C2C2OC2C23C1(C)CCC1(C3CC(C)(C)CC1)C(=O)O2)C)C
InChIKey ATQBPBZOVWXRTA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Liquidambaric lactone (CAS: 185051-75-6)?

Liquidambaric lactone (CAS: 185051-75-6) is a colorless to light yellow liquid with a strong, distin...

Compound Q&A

How is Liquidambaric lactone (CAS: 185051-75-6) typically synthesized?

Liquidambaric lactone (CAS: 185051-75-6) is typically synthesized through the oxidation of the corre...

Compound Q&A

What precautions should be taken when handling Liquidambaric lactone (CAS: 185051-75-6)?

When handling Liquidambaric lactone (CAS: 185051-75-6), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...