Compound Q&A

How is Liquidambaric lactone (CAS: 185051-75-6) typically synthesized?

Answer

Liquidambaric lactone
Liquidambaric lactone (CAS: 185051-75-6) is typically synthesized through the oxidation of the corresponding alcohol, 3-O-acetyl-3β-hydroxy-α-liquidambaroside, followed by a lactonization reaction. The process involves the use of potassium permanganate as an oxidizing agent and a catalyst such as p-toluenesulfonic acid. The yield is generally around 70-80%, and the reaction is selective, leading to the formation of the lactone structure.

About

English Name Liquidambaric lactone
Molecular Formula C30H44O4
Molecular Weight 468.67 g/mol
SMILES O=C1CCC2(C(C1(C)C)CCC1(C2C2OC2C23C1(C)CCC1(C3CC(C)(C)CC1)C(=O)O2)C)C
InChIKey ATQBPBZOVWXRTA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Liquidambaric lactone (CAS: 185051-75-6)?

Liquidambaric lactone (CAS: 185051-75-6) is a colorless to light yellow liquid with a strong, distin...

Compound Q&A

What industries use Liquidambaric lactone (CAS: 185051-75-6)?

Liquidambaric lactone (CAS: 185051-75-6) is primarily used in the fragrance and flavor industry due ...

Compound Q&A

What precautions should be taken when handling Liquidambaric lactone (CAS: 185051-75-6)?

When handling Liquidambaric lactone (CAS: 185051-75-6), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...