Compound Q&A

What precautions should be taken when handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

Answer

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
When handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the use of a fume hood to minimize exposure to vapors. Spills should be cleaned up immediately using appropriate absorbents, and contaminated materials should be disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 23256-50-0
English Name N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
Molecular Formula C10H12Cl2N4O2
Molecular Weight 291.14 g/mol
SMILES CC(=O)O.C1=CC(=C(C(=C1)Cl)C=NN=C(N)N)Cl
InChIKey MCSPBPXATWBACD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is a crystalline so...

Compound Q&A

How is N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) typically synthesized?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is typically synthe...

Compound Q&A

What industries use N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) has applications in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...