Compound Q&A

How is N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) typically synthesized?

Answer

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is typically synthesized via condensation of 2,6-dichlorobenzaldehyde and hydrazine hydrate, followed by acetylation. The synthesis involves heating the reactants under basic conditions and then converting the intermediate to the acetate form. The process requires careful control of pH and temperature to achieve high selectivity and yield.

About

CAS No 23256-50-0
English Name N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
Molecular Formula C10H12Cl2N4O2
Molecular Weight 291.14 g/mol
SMILES CC(=O)O.C1=CC(=C(C(=C1)Cl)C=NN=C(N)N)Cl
InChIKey MCSPBPXATWBACD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is a crystalline so...

Compound Q&A

What industries use N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) has applications in...

Compound Q&A

What precautions should be taken when handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

When handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...