Compound Q&A

What are the physical and chemical properties of N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

Answer

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is a crystalline solid with a molecular weight of approximately 326.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol. This compound is generally stable under normal conditions but can be reactive towards strong acids and bases. It is an amide derivative, which can participate in amide hydrolysis and condensation reactions.

About

CAS No 23256-50-0
English Name N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
Molecular Formula C10H12Cl2N4O2
Molecular Weight 291.14 g/mol
SMILES CC(=O)O.C1=CC(=C(C(=C1)Cl)C=NN=C(N)N)Cl
InChIKey MCSPBPXATWBACD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) typically synthesized?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is typically synthe...

Compound Q&A

What industries use N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) has applications in...

Compound Q&A

What precautions should be taken when handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

When handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...