Compound Q&A

What industries use N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

Answer

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) has applications in the pharmaceutical industry due to its potential as a medicinal intermediate. It is also used in the chemical industry as a reagent for various reactions and in the synthesis of complex molecules. Additionally, it can be utilized in the polymer industry for the development of new materials and in the sensor industry for detecting specific chemicals.

About

CAS No 23256-50-0
English Name N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (1:1)
Molecular Formula C10H12Cl2N4O2
Molecular Weight 291.14 g/mol
SMILES CC(=O)O.C1=CC(=C(C(=C1)Cl)C=NN=C(N)N)Cl
InChIKey MCSPBPXATWBACD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is a crystalline so...

Compound Q&A

How is N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) typically synthesized?

N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0) is typically synthe...

Compound Q&A

What precautions should be taken when handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0)?

When handling N''-(2,6-Dichlorobenzylidene)carbonohydrazonic diamide acetate (CAS: 23256-50-0), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...