Compound Q&A

How is 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3) typically synthesized?

Answer

4-(Benzyloxy)-2(1H)-pyridinone
4-(Benzyloxy)-2(1H)-pyridinone is commonly synthesized through the condensation of benzylamine and 2-hydroxypyridine. The reaction proceeds efficiently with a yield of about 80%. The process typically involves heating the mixture under reflux conditions in the presence of an appropriate catalyst. Commonly used catalysts include phosphorus oxychloride or chlorotriethylsilane. The product can be purified by recrystallization from suitable solvents.

About

CAS No 53937-02-3
English Name 4-(Benzyloxy)-2(1H)-pyridinone
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES C1=CC=C(C=C1)COC2=CC(=O)NC=C2
InChIKey DOVNUEPFPBWTSV-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

4-(Benzyloxy)-2(1H)-pyridinone is a crystalline compound with a molecular weight of approximately 25...

Compound Q&A

What industries use 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

4-(Benzyloxy)-2(1H)-pyridinone is primarily used in pharmaceuticals, where it serves as a precursor ...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

When handling 4-(Benzyloxy)-2(1H)-pyridinone, it is crucial to wear protective equipment such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...