Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

Answer

4-(Benzyloxy)-2(1H)-pyridinone
4-(Benzyloxy)-2(1H)-pyridinone is a crystalline compound with a molecular weight of approximately 250.26 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. The compound is relatively stable and exhibits limited reactivity under normal conditions, making it suitable for various synthetic applications. It forms white to off-white crystals and is typically stored at room temperature away from direct sunlight.

About

CAS No 53937-02-3
English Name 4-(Benzyloxy)-2(1H)-pyridinone
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES C1=CC=C(C=C1)COC2=CC(=O)NC=C2
InChIKey DOVNUEPFPBWTSV-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3) typically synthesized?

4-(Benzyloxy)-2(1H)-pyridinone is commonly synthesized through the condensation of benzylamine and 2...

Compound Q&A

What industries use 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

4-(Benzyloxy)-2(1H)-pyridinone is primarily used in pharmaceuticals, where it serves as a precursor ...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-2(1H)-pyridinone (CAS: 53937-02-3)?

When handling 4-(Benzyloxy)-2(1H)-pyridinone, it is crucial to wear protective equipment such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...