Compound Q&A

What precautions should be taken when handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Answer

Ruthenium(2+) di(2,4-cyclopentadienide)
When handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4), it is crucial to use personal protective equipment (PPE) such as gloves and goggles. Work should be conducted in a well-ventilated area or a fume hood. In case of a spill, clean up with appropriate tools and materials, ensuring not to inhale the dust. Refer to the Safety Data Sheet (SDS) for detailed handling and storage instructions. Always follow laboratory safety guidelines to avoid potential hazards.

About

CAS No 1287-13-4
English Name Ruthenium(2+) di(2,4-cyclopentadienide)
Molecular Formula C10H10Ru
Molecular Weight 231.26 g/mol
EINECS 215-065-2
SMILES C12=C3[Ru+2]1456789(C%10=C6C7=C8[C-]9%10)C2=C4[C-]53
InChIKey FZHCFNGSGGGXEH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is a crystalline solid with a molecular wei...

Compound Q&A

How is Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) typically synthesized?

Ruthenium(2+) di(2,4-cyclopentadienide) is typically synthesized by the reaction of ruthenium(II) ch...

Compound Q&A

What industries use Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is used in various industries due to its un...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...