Compound Q&A

What industries use Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Answer

Ruthenium(2+) di(2,4-cyclopentadienide)
Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is used in various industries due to its unique electronic and catalytic properties. It is commonly found in pharmaceuticals for drug development, polymers for advanced materials, sensors for detection and analysis, and semiconductors for electronic devices. Its applications are expanding in areas like catalysis and material science.

About

CAS No 1287-13-4
English Name Ruthenium(2+) di(2,4-cyclopentadienide)
Molecular Formula C10H10Ru
Molecular Weight 231.26 g/mol
EINECS 215-065-2
SMILES C12=C3[Ru+2]1456789(C%10=C6C7=C8[C-]9%10)C2=C4[C-]53
InChIKey FZHCFNGSGGGXEH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is a crystalline solid with a molecular wei...

Compound Q&A

How is Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) typically synthesized?

Ruthenium(2+) di(2,4-cyclopentadienide) is typically synthesized by the reaction of ruthenium(II) ch...

Compound Q&A

What precautions should be taken when handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

When handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4), it is crucial to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...