Compound Q&A

How is Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) typically synthesized?

Answer

Ruthenium(2+) di(2,4-cyclopentadienide)
Ruthenium(2+) di(2,4-cyclopentadienide) is typically synthesized by the reaction of ruthenium(II) chloride with 2,4-cyclopentadienyl dihydride in the presence of a base. This process yields a complex that can be further characterized and used in various applications. The yield and selectivity can be optimized by controlling reaction conditions and using appropriate catalysts. Detailed synthesis procedures are available in the literature on coordination chemistry.

About

CAS No 1287-13-4
English Name Ruthenium(2+) di(2,4-cyclopentadienide)
Molecular Formula C10H10Ru
Molecular Weight 231.26 g/mol
EINECS 215-065-2
SMILES C12=C3[Ru+2]1456789(C%10=C6C7=C8[C-]9%10)C2=C4[C-]53
InChIKey FZHCFNGSGGGXEH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is used in various industries due to its un...

Compound Q&A

What precautions should be taken when handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

When handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4), it is crucial to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...