Compound Q&A

What are the physical and chemical properties of Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Answer

Ruthenium(2+) di(2,4-cyclopentadienide)
Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is a crystalline solid with a molecular weight of approximately 218.11 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound shows moderate reactivity, particularly towards oxidizing agents. It is often used in coordination chemistry and catalysis. For more detailed properties, refer to spectroscopic data and literature on coordination compounds.

About

CAS No 1287-13-4
English Name Ruthenium(2+) di(2,4-cyclopentadienide)
Molecular Formula C10H10Ru
Molecular Weight 231.26 g/mol
EINECS 215-065-2
SMILES C12=C3[Ru+2]1456789(C%10=C6C7=C8[C-]9%10)C2=C4[C-]53
InChIKey FZHCFNGSGGGXEH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) typically synthesized?

Ruthenium(2+) di(2,4-cyclopentadienide) is typically synthesized by the reaction of ruthenium(II) ch...

Compound Q&A

What industries use Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4) is used in various industries due to its un...

Compound Q&A

What precautions should be taken when handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4)?

When handling Ruthenium(2+) di(2,4-cyclopentadienide) (CAS: 1287-13-4), it is crucial to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...