Compound Q&A

What precautions should be taken when handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

Answer

(3-(Naphthalen-1-yl)phenyl)boronic acid
When handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8), it is essential to use proper personal protective equipment (PPE) such as gloves and safety goggles. It should be stored in a cool, dry place away from strong acids and bases. In case of a spill, immediately clean up with appropriate absorbents and ensure the area is well-ventilated. Safety data sheets (SDS) should be consulted for detailed handling instructions.

About

English Name (3-(Naphthalen-1-yl)phenyl)boronic acid
Molecular Formula C16H13BO2
Molecular Weight 248.09 g/mol
SMILES B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O
InChIKey HFXYUCJLQZCNPD-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is a crystalline solid with a molecular w...

Compound Q&A

How is (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) typically synthesized?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) can be synthesized through a boronic acid...

Compound Q&A

What industries use (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is predominantly used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...