Compound Q&A

What are the physical and chemical properties of (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

Answer

(3-(Naphthalen-1-yl)phenyl)boronic acid
(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is a crystalline solid with a molecular weight of approximately 276.27 g/mol. It has low solubility in water but is more soluble in organic solvents like dimethylformamide (DMF). This compound exhibits moderate reactivity, especially under basic conditions. It is often used in Suzuki coupling reactions due to its boronic acid functionality.

About

English Name (3-(Naphthalen-1-yl)phenyl)boronic acid
Molecular Formula C16H13BO2
Molecular Weight 248.09 g/mol
SMILES B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O
InChIKey HFXYUCJLQZCNPD-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) typically synthesized?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) can be synthesized through a boronic acid...

Compound Q&A

What industries use (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is predominantly used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

When handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8), it is essential to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...