Compound Q&A

What industries use (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

Answer

(3-(Naphthalen-1-yl)phenyl)boronic acid
(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is predominantly used in the pharmaceutical and polymer industries. It serves as a key reactant in the synthesis of various drugs and also finds application in the production of functional polymers. Additionally, it can be utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name (3-(Naphthalen-1-yl)phenyl)boronic acid
Molecular Formula C16H13BO2
Molecular Weight 248.09 g/mol
SMILES B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O
InChIKey HFXYUCJLQZCNPD-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) is a crystalline solid with a molecular w...

Compound Q&A

How is (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) typically synthesized?

(3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8) can be synthesized through a boronic acid...

Compound Q&A

What precautions should be taken when handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8)?

When handling (3-(Naphthalen-1-yl)phenyl)boronic acid (CAS: 881913-20-8), it is essential to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...