Compound Q&A

What industries use 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

Answer

4-Chloro-3-methoxy-2-methylpyridine 1-oxide
4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is primarily used in the pharmaceutical, pesticide, and fine chemical industries. It serves as a precursor for the synthesis of various drugs and agrochemicals. Its application in the pharmaceutical industry includes the production of APIs (active pharmaceutical ingredients) and intermediates for drug synthesis. It is also utilized in the development of new pesticides and herbicides.

About

English Name 4-Chloro-3-methoxy-2-methylpyridine 1-oxide
Molecular Formula C7H8ClNO2
Molecular Weight 173.6 g/mol
SMILES CC1=[N+](C=CC(=C1OC)Cl)[O-]
InChIKey TWXMQDRFBLSXFN-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is a crystalline solid with a molecul...

Compound Q&A

How is 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) typically synthesized?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is typically synthesized through the ...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

When handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9), it is essential to wea...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...