Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

Answer

4-Chloro-3-methoxy-2-methylpyridine 1-oxide
4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is a crystalline solid with a molecular weight of approximately 208.02 g/mol. It has a melting point of about 113-115°C and is slightly soluble in water. This compound is known for its reactivity towards nucleophiles and electrophiles, making it useful in organic synthesis. It can form stable solutions in organic solvents like ethanol and acetone.

About

English Name 4-Chloro-3-methoxy-2-methylpyridine 1-oxide
Molecular Formula C7H8ClNO2
Molecular Weight 173.6 g/mol
SMILES CC1=[N+](C=CC(=C1OC)Cl)[O-]
InChIKey TWXMQDRFBLSXFN-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) typically synthesized?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is typically synthesized through the ...

Compound Q&A

What industries use 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

When handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...