Compound Q&A

How is 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) typically synthesized?

Answer

4-Chloro-3-methoxy-2-methylpyridine 1-oxide
4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is typically synthesized through the methylation of 4-chloro-3-methoxy-2-pyridinecarbaldehyde followed by oxidation. This involves the use of methyl iodide and a strong base, such as sodium hydride, in an organic solvent. The reaction is conducted at room temperature, and the final product is obtained by oxidizing the intermediate with potassium permanganate or a similar oxidizing agent.

About

English Name 4-Chloro-3-methoxy-2-methylpyridine 1-oxide
Molecular Formula C7H8ClNO2
Molecular Weight 173.6 g/mol
SMILES CC1=[N+](C=CC(=C1OC)Cl)[O-]
InChIKey TWXMQDRFBLSXFN-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is a crystalline solid with a molecul...

Compound Q&A

What industries use 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9)?

When handling 4-Chloro-3-methoxy-2-methylpyridine 1-oxide (CAS: 122307-41-9), it is essential to wea...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...