Compound Q&A

What are the physical and chemical properties of Azido-PEG4-Amine (CAS: 951671-92-4)?

Answer

Azido-PEG4-Amine
Azido-PEG4-Amine (CAS: 951671-92-4) is a polyethylene glycol derivative with a molecular weight of approximately 450 Da. It is a white or off-white solid with a crystalline form. The compound has a high solubility in common organic solvents such as DMSO and DMF. It is reactive towards amine groups, enabling its use in conjugation reactions. The compound can be used in polymer synthesis and bioconjugation applications.

About

English Name Azido-PEG4-Amine
Molecular Formula C10H22N4O4
Molecular Weight 262.31 g/mol
SMILES C(COCCOCCOCCOCCN=[N+]=[N-])N
InChIKey ZMBGKXBIVYXREN-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Azido-PEG4-Amine (CAS: 951671-92-4) typically synthesized?

Azido-PEG4-Amine (CAS: 951671-92-4) is typically synthesized by condensation of azide and amine func...

Compound Q&A

What industries use Azido-PEG4-Amine (CAS: 951671-92-4)?

Azido-PEG4-Amine (CAS: 951671-92-4) is widely used in the pharmaceutical industry for drug delivery ...

Compound Q&A

What precautions should be taken when handling Azido-PEG4-Amine (CAS: 951671-92-4)?

When handling Azido-PEG4-Amine (CAS: 951671-92-4), appropriate personal protective equipment (PPE) i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...