Compound Q&A

What precautions should be taken when handling 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

Answer

1-benzofuran-2-carboxylic acid
When handling 1-Benzofuran-2-carboxylic acid (CAS: 496-41-3), wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store it in a well-ventilated area away from heat sources. Use a fume hood during operations. In case of spill, use appropriate absorbent materials and dispose of the waste according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed information on handling and emergency procedures.

About

CAS No 496-41-3
English Name 1-benzofuran-2-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14 g/mol
SMILES C1=CC=C2C(=C1)C=C(O2)C(=O)O
InChIKey OFFSPAZVIVZPHU-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-benzofuran-2-carboxylic acid (CAS: 496-41-3) typically synthesized?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) can be synthesized by the condensation of benzoic aci...

Compound Q&A

What industries use 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is used in various industries, including pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...