Compound Q&A

What are the physical and chemical properties of 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

Answer

1-benzofuran-2-carboxylic acid
1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is a crystalline solid with a molecular weight of approximately 184.17 g/mol. It has a pKa of about 4.3 and is slightly soluble in water. Chemically, it is reactive towards nucleophiles and can undergo esterification and amide formation reactions. It is also prone to hydrolysis under basic conditions.

About

CAS No 496-41-3
English Name 1-benzofuran-2-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14 g/mol
SMILES C1=CC=C2C(=C1)C=C(O2)C(=O)O
InChIKey OFFSPAZVIVZPHU-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 1-benzofuran-2-carboxylic acid (CAS: 496-41-3) typically synthesized?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) can be synthesized by the condensation of benzoic aci...

Compound Q&A

What industries use 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

When handling 1-Benzofuran-2-carboxylic acid (CAS: 496-41-3), wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...