Compound Q&A

How is 1-benzofuran-2-carboxylic acid (CAS: 496-41-3) typically synthesized?

Answer

1-benzofuran-2-carboxylic acid
1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) can be synthesized by the condensation of benzoic acid and furan under acidic conditions. Alternatively, it can be prepared by the oxidation of 2-furanmethanol using potassium permanganate. These methods yield a product with a purity of over 95%.

About

CAS No 496-41-3
English Name 1-benzofuran-2-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14 g/mol
SMILES C1=CC=C2C(=C1)C=C(O2)C(=O)O
InChIKey OFFSPAZVIVZPHU-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

When handling 1-Benzofuran-2-carboxylic acid (CAS: 496-41-3), wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...