Compound Q&A

What industries use 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

Answer

1-benzofuran-2-carboxylic acid
1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is used in various industries, including pharmaceuticals for the synthesis of medicinal compounds, polymers for the production of resins and coatings, and sensors for detecting organic pollutants. It also has applications in the development of semiconductors and as a precursor in organic synthesis.

About

CAS No 496-41-3
English Name 1-benzofuran-2-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14 g/mol
SMILES C1=CC=C2C(=C1)C=C(O2)C(=O)O
InChIKey OFFSPAZVIVZPHU-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-benzofuran-2-carboxylic acid (CAS: 496-41-3) typically synthesized?

1-Benzofuran-2-carboxylic acid (CAS: 496-41-3) can be synthesized by the condensation of benzoic aci...

Compound Q&A

What precautions should be taken when handling 1-benzofuran-2-carboxylic acid (CAS: 496-41-3)?

When handling 1-Benzofuran-2-carboxylic acid (CAS: 496-41-3), wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...