Compound Q&A

What precautions should be taken when handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

Answer

(3-Fluoro-4-formylphenyl)boronic acid
When handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be carried out in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures. Storage should be in a cool, dry place, away from heat and sources of ignition.

About

English Name (3-Fluoro-4-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=CC(=C(C=C1)C=O)F)(O)O
InChIKey NZNRMUVHUVCIBR-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is a white crystalline powder. It has a mol...

Compound Q&A

How is (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) typically synthesized?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is typically synthesized via the coupling o...

Compound Q&A

What industries use (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is utilized in the pharmaceutical and mater...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...