Compound Q&A

What industries use (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

Answer

(3-Fluoro-4-formylphenyl)boronic acid
(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is utilized in the pharmaceutical and materials science industries. In pharmaceuticals, it serves as a key intermediate in the synthesis of various drug compounds. In materials science, it is used in the development of advanced polymers and sensors. Its boronic acid functionality makes it particularly useful in organic synthesis and catalysis.

About

English Name (3-Fluoro-4-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=CC(=C(C=C1)C=O)F)(O)O
InChIKey NZNRMUVHUVCIBR-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is a white crystalline powder. It has a mol...

Compound Q&A

How is (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) typically synthesized?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is typically synthesized via the coupling o...

Compound Q&A

What precautions should be taken when handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

When handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...