Compound Q&A

How is (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) typically synthesized?

Answer

(3-Fluoro-4-formylphenyl)boronic acid
(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is typically synthesized via the coupling of 3-fluoro-4-formylphenol with boron tribromide in an organic solvent. The reaction selectively forms the boronic acid ester with high yield. Commonly, this process is carried out under mild conditions to ensure high selectivity and purity of the product.

About

English Name (3-Fluoro-4-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=CC(=C(C=C1)C=O)F)(O)O
InChIKey NZNRMUVHUVCIBR-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is a white crystalline powder. It has a mol...

Compound Q&A

What industries use (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is utilized in the pharmaceutical and mater...

Compound Q&A

What precautions should be taken when handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

When handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...