Compound Q&A

What are the physical and chemical properties of (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

Answer

(3-Fluoro-4-formylphenyl)boronic acid
(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is a white crystalline powder. It has a molecular weight of approximately 245.13 g/mol. The compound is sparingly soluble in water but soluble in organic solvents like ethanol and acetonitrile. Chemically, it is known for its reactivity towards nucleophiles and its ability to form stable complexes with transition metals. It is used as a boron source in various synthetic reactions.

About

English Name (3-Fluoro-4-formylphenyl)boronic acid
Molecular Formula C7H6BFO3
Molecular Weight 167.93 g/mol
SMILES B(C1=CC(=C(C=C1)C=O)F)(O)O
InChIKey NZNRMUVHUVCIBR-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) typically synthesized?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is typically synthesized via the coupling o...

Compound Q&A

What industries use (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

(3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9) is utilized in the pharmaceutical and mater...

Compound Q&A

What precautions should be taken when handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9)?

When handling (3-Fluoro-4-formylphenyl)boronic acid (CAS: 248270-25-9), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...