Compound Q&A

What industries use Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Answer

Diethyl 2,6-pyridinedicarboxylate
Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It also finds applications in the polymer industry, where it acts as a plasticizer or stabilizer. Additionally, it is used in the production of sensors and semiconductors due to its chemical stability and specific functional groups.

About

CAS No 15658-60-3
English Name Diethyl 2,6-pyridinedicarboxylate
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES CCOC(=O)C1=NC(=CC=C1)C(=O)OCC
InChIKey KTOBUCHVPBPHMK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is a crystalline solid with a molecular weight o...

Compound Q&A

How is Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) typically synthesized?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is commonly synthesized by the condensation of 2...

Compound Q&A

What precautions should be taken when handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

When handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...