Compound Q&A

What are the physical and chemical properties of Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Answer

Diethyl 2,6-pyridinedicarboxylate
Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is a crystalline solid with a molecular weight of approximately 250.27 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetonitrile. Chemically, it is relatively stable but can undergo ester hydrolysis under acidic or basic conditions. It has a high melting point around 230°C and is a colorless to pale yellow crystalline compound.

About

CAS No 15658-60-3
English Name Diethyl 2,6-pyridinedicarboxylate
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES CCOC(=O)C1=NC(=CC=C1)C(=O)OCC
InChIKey KTOBUCHVPBPHMK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) typically synthesized?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is commonly synthesized by the condensation of 2...

Compound Q&A

What industries use Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

When handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...