Compound Q&A

How is Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) typically synthesized?

Answer

Diethyl 2,6-pyridinedicarboxylate
Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is commonly synthesized by the condensation of 2,6-pyridinedicarboxylic acid with diethylamine. The reaction typically proceeds under mild conditions with a yield of around 80-85%. Catalysts such as potassium carbonate are often used to facilitate the reaction and improve selectivity. The synthesis is carried out in organic solvents like methanol or ethanol.

About

CAS No 15658-60-3
English Name Diethyl 2,6-pyridinedicarboxylate
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES CCOC(=O)C1=NC(=CC=C1)C(=O)OCC
InChIKey KTOBUCHVPBPHMK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3)?

When handling Diethyl 2,6-pyridinedicarboxylate (CAS: 15658-60-3), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...