Compound Q&A

What industries use 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

Answer

3,3'-Methylenebis(6-hydroxybenzoic acid)
3,3'-Methylenebis(6-hydroxybenzoic acid) is used in various industries. It is a key intermediate in the production of pharmaceuticals, where it serves as a building block for certain drug molecules. In the polymer industry, it can be used to modify the properties of polymers. It also finds applications in the production of sensors and semiconductors due to its optical and electronic properties.

About

CAS No 122-25-8
English Name 3,3'-Methylenebis(6-hydroxybenzoic acid)
Molecular Formula C15H12O6
Molecular Weight 288.25 g/mol
SMILES C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O
InChIKey JWQFKVGACKJIAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

3,3'-Methylenebis(6-hydroxybenzoic acid) is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8) typically synthesized?

3,3'-Methylenebis(6-hydroxybenzoic acid) is typically synthesized via a condensation reaction betwee...

Compound Q&A

What precautions should be taken when handling 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

When handling 3,3'-Methylenebis(6-hydroxybenzoic acid), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...