Compound Q&A

How is 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8) typically synthesized?

Answer

3,3'-Methylenebis(6-hydroxybenzoic acid)
3,3'-Methylenebis(6-hydroxybenzoic acid) is typically synthesized via a condensation reaction between 6-hydroxybenzoic acid and formaldehyde. The reaction is often catalyzed by acids or bases, and the yield is usually around 85-90%. The process involves heating the reactants under reflux conditions for several hours.

About

CAS No 122-25-8
English Name 3,3'-Methylenebis(6-hydroxybenzoic acid)
Molecular Formula C15H12O6
Molecular Weight 288.25 g/mol
SMILES C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O
InChIKey JWQFKVGACKJIAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

3,3'-Methylenebis(6-hydroxybenzoic acid) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

3,3'-Methylenebis(6-hydroxybenzoic acid) is used in various industries. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

When handling 3,3'-Methylenebis(6-hydroxybenzoic acid), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...