Compound Q&A

What are the physical and chemical properties of 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

Answer

3,3'-Methylenebis(6-hydroxybenzoic acid)
3,3'-Methylenebis(6-hydroxybenzoic acid) is a crystalline compound with a molecular weight of approximately 268.15 g/mol. It has a melting point of 245-248°C. The compound is slightly soluble in water and ethanol. Chemically, it is relatively stable but can react with bases to form sodium or potassium salts. It exhibits weak acidity due to its phenolic hydroxyl groups.

About

CAS No 122-25-8
English Name 3,3'-Methylenebis(6-hydroxybenzoic acid)
Molecular Formula C15H12O6
Molecular Weight 288.25 g/mol
SMILES C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O
InChIKey JWQFKVGACKJIAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8) typically synthesized?

3,3'-Methylenebis(6-hydroxybenzoic acid) is typically synthesized via a condensation reaction betwee...

Compound Q&A

What industries use 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

3,3'-Methylenebis(6-hydroxybenzoic acid) is used in various industries. It is a key intermediate in ...

Compound Q&A

What precautions should be taken when handling 3,3'-Methylenebis(6-hydroxybenzoic acid) (CAS: 122-25-8)?

When handling 3,3'-Methylenebis(6-hydroxybenzoic acid), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...