Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

Answer

2-Fluoro-4-methoxyphenylacetic acid
When handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0), proper personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a lab coat. The compound should be stored in a cool, dry place away from sources of heat and light. Fume hoods should be used during handling to minimize exposure. In case of a spill, it should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2-Fluoro-4-methoxyphenylacetic acid
Molecular Formula C9H9FO3
Molecular Weight 184.166 g/mol
SMILES COC1=CC(=C(C=C1)CC(=O)O)F
InChIKey WGODSCYEKWDSAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

2-Fluoro-4-methoxyphenylacetic acid is a white to off-white crystalline solid with a molecular weigh...

Compound Q&A

How is 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0) typically synthesized?

2-Fluoro-4-methoxyphenylacetic acid can be synthesized through a multi-step process involving the pr...

Compound Q&A

What industries use 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

2-Fluoro-4-methoxyphenylacetic acid is primarily used in the pharmaceutical industry for the synthes...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...