Compound Q&A

What industries use 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

Answer

2-Fluoro-4-methoxyphenylacetic acid
2-Fluoro-4-methoxyphenylacetic acid is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also utilized in the polymer industry for the modification of polymer properties and in the semiconductor industry for the development of novel materials. Additionally, it finds applications in the production of sensors and as a precursor in organic synthesis due to its unique functional groups.

About

English Name 2-Fluoro-4-methoxyphenylacetic acid
Molecular Formula C9H9FO3
Molecular Weight 184.166 g/mol
SMILES COC1=CC(=C(C=C1)CC(=O)O)F
InChIKey WGODSCYEKWDSAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

2-Fluoro-4-methoxyphenylacetic acid is a white to off-white crystalline solid with a molecular weigh...

Compound Q&A

How is 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0) typically synthesized?

2-Fluoro-4-methoxyphenylacetic acid can be synthesized through a multi-step process involving the pr...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

When handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0), proper personal protective equ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...