Compound Q&A

How is 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0) typically synthesized?

Answer

2-Fluoro-4-methoxyphenylacetic acid
2-Fluoro-4-methoxyphenylacetic acid can be synthesized through a multi-step process involving the protection of the hydroxyl group, fluoroalkylation, and deprotection of the acetylation. A common approach involves the reaction of 4-methoxyphenylacetic acid with a fluoroalkylating agent in the presence of a base. The yield is typically around 70-80%, and the reaction is catalyzed by a suitable base such as sodium hydride or potassium tert-butoxide.

About

English Name 2-Fluoro-4-methoxyphenylacetic acid
Molecular Formula C9H9FO3
Molecular Weight 184.166 g/mol
SMILES COC1=CC(=C(C=C1)CC(=O)O)F
InChIKey WGODSCYEKWDSAV-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

2-Fluoro-4-methoxyphenylacetic acid is a white to off-white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

2-Fluoro-4-methoxyphenylacetic acid is primarily used in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0)?

When handling 2-Fluoro-4-methoxyphenylacetic acid (CAS: 883531-28-0), proper personal protective equ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...