Compound Q&A

What precautions should be taken when handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Answer

methyl 3-iodo-1H-indazole-5-carboxylate
When handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood due to its potential volatility and reactivity. Spills should be cleaned up immediately with appropriate absorbent materials, and the area should be thoroughly washed. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name methyl 3-iodo-1H-indazole-5-carboxylate
Molecular Formula C9H7IN2O2
Molecular Weight 302.07 g/mol
SMILES COC(=O)C1=CC2=C(NN=C2C=C1)I
InChIKey JQHYEHRKSDHNFC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is a crystalline solid with a molecular w...

Compound Q&A

How is methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) typically synthesized?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is typically synthesized via a reaction b...

Compound Q&A

What industries use methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is primarily used in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...