Compound Q&A

How is methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) typically synthesized?

Answer

methyl 3-iodo-1H-indazole-5-carboxylate
Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is typically synthesized via a reaction between methyl 3-bromo-1H-indazole-5-carboxylate and sodium iodide in the presence of an appropriate base such as sodium hydride. The reaction yields the desired compound with good selectivity and moderate to high yields, depending on the conditions.

About

English Name methyl 3-iodo-1H-indazole-5-carboxylate
Molecular Formula C9H7IN2O2
Molecular Weight 302.07 g/mol
SMILES COC(=O)C1=CC2=C(NN=C2C=C1)I
InChIKey JQHYEHRKSDHNFC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is a crystalline solid with a molecular w...

Compound Q&A

What industries use methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

When handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...