Compound Q&A

What industries use methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Answer

methyl 3-iodo-1H-indazole-5-carboxylate
Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is primarily used in the pharmaceutical industry for the synthesis of complex organic compounds. It may also find applications in the polymer industry for developing new materials with specific properties. Additionally, it could be of interest in the sensor technology and semiconductor industries for specialized applications.

About

English Name methyl 3-iodo-1H-indazole-5-carboxylate
Molecular Formula C9H7IN2O2
Molecular Weight 302.07 g/mol
SMILES COC(=O)C1=CC2=C(NN=C2C=C1)I
InChIKey JQHYEHRKSDHNFC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is a crystalline solid with a molecular w...

Compound Q&A

How is methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) typically synthesized?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is typically synthesized via a reaction b...

Compound Q&A

What precautions should be taken when handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

When handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...