Compound Q&A

What are the physical and chemical properties of methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Answer

methyl 3-iodo-1H-indazole-5-carboxylate
Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is a crystalline solid with a molecular weight of approximately 330.03 g/mol. It has poor water solubility but is soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal storage conditions but should be handled with care due to its reactivity.

About

English Name methyl 3-iodo-1H-indazole-5-carboxylate
Molecular Formula C9H7IN2O2
Molecular Weight 302.07 g/mol
SMILES COC(=O)C1=CC2=C(NN=C2C=C1)I
InChIKey JQHYEHRKSDHNFC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) typically synthesized?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is typically synthesized via a reaction b...

Compound Q&A

What industries use methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

Methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0)?

When handling methyl 3-iodo-1H-indazole-5-carboxylate (CAS: 885271-25-0), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...