Compound Q&A

What precautions should be taken when handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

Answer

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
When handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood due to its potential to release vapors. Spills should be cleaned up immediately using appropriate absorbents and following the manufacturer's guidelines. MSDS (Material Safety Data Sheet) should be consulted for detailed safety information and emergency procedures. The compound is generally stable but should be stored in a cool, dry place away from strong acids and bases.

About

English Name (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CC(=O)O
InChIKey VEFHUWJIRFTGRB-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is a white crystalline solid with a...

Compound Q&A

How is (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6) typically synthesized?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is typically synthesized via a mult...

Compound Q&A

What industries use (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is primarily used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...