Compound Q&A

What industries use (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

Answer

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It is also utilized in the polymer industry for the development of new materials and in the sensor industry for the fabrication of chemical sensors. In the semiconductor industry, the compound can be used as a precursor in the production of certain materials with specific electronic properties.

About

English Name (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CC(=O)O
InChIKey VEFHUWJIRFTGRB-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is a white crystalline solid with a...

Compound Q&A

How is (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6) typically synthesized?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is typically synthesized via a mult...

Compound Q&A

What precautions should be taken when handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

When handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...