Compound Q&A

How is (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6) typically synthesized?

Answer

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is typically synthesized via a multi-step process involving the protection of the azetidinone functionality followed by acetylation and subsequent deprotection. Commonly, this involves using reagents such as tert-butyldimethylsilyl chloride for protection, followed by acetic anhydride for acetylation, and finally, HBr for deprotection. The overall yield is around 70-80%, with good regioselectivity.

About

English Name (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CC(=O)O
InChIKey VEFHUWJIRFTGRB-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is a white crystalline solid with a...

Compound Q&A

What industries use (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

When handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...