Compound Q&A

What are the physical and chemical properties of (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

Answer

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is a white crystalline solid with a molecular weight of approximately 224.3 g/mol. It has a high solubility in water and organic solvents. The compound exhibits good reactivity towards nucleophiles and is generally stable under normal conditions but susceptible to hydrolysis under acidic or basic conditions. The compound is used as an intermediate in pharmaceuticals and other applications.

About

English Name (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C1)CC(=O)O
InChIKey VEFHUWJIRFTGRB-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6) typically synthesized?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is typically synthesized via a mult...

Compound Q&A

What industries use (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid (CAS: 183062-96-6)?

When handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)acetic acid, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...